About 1,2-dinitroazetidine;sulfuric acid
1,2-dinitroazetidine;sulfuric acid (PubChem CID 126582238) has the molecular formula C3H7N3O8S
and a molecular weight of 245.17 g/mol. Its IUPAC name is 1,2-dinitroazetidine;sulfuric acid.
Molecular Properties
| Compound Name | 1,2-dinitroazetidine;sulfuric acid |
| PubChem CID | 126582238 |
| Molecular Formula | C3H7N3O8S |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 1,2-dinitroazetidine;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[N+]([O-])C1CCN1[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N3O4.H2O4S/c7-5(8)3-1-2-4(3)6(9)10;1-5(2,3)4/h3H,1-2H2;(H2,1,2,3,4) |
| InChIKey | UXPDSYGRSNAAEG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dinitroazetidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dinitroazetidine;sulfuric acid?
The IUPAC name of 1,2-dinitroazetidine;sulfuric acid (CID 126582238) is 1,2-dinitroazetidine;sulfuric acid.
What is the SMILES notation for 1,2-dinitroazetidine;sulfuric acid?
The canonical SMILES for 1,2-dinitroazetidine;sulfuric acid is O=S(=O)(O)O.O=[N+]([O-])C1CCN1[N+](=O)[O-].
What is the InChIKey of 1,2-dinitroazetidine;sulfuric acid?
The InChIKey is UXPDSYGRSNAAEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O4.H2O4S/c7-5(8)3-1-2-4(3)6(9)10;1-5(2,3)4/h3H,1-2H2;(H2,1,2,3,4).
What are the key properties of 1,2-dinitroazetidine;sulfuric acid?
1,2-dinitroazetidine;sulfuric acid has a molecular weight of 245.17 g/mol, XLogP of -1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dinitroazetidine;sulfuric acid is sourced from PubChem (CID 126582238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).