About 1-nitropiperidin-4-ol
1-nitropiperidin-4-ol (PubChem CID 141406661) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-nitropiperidin-4-ol.
Molecular Properties
| Compound Name | 1-nitropiperidin-4-ol |
| PubChem CID | 141406661 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1-nitropiperidin-4-ol |
| SMILES | O=[N+]([O-])N1CCC(O)CC1 |
| InChI | InChI=1S/C5H10N2O3/c8-5-1-3-6(4-2-5)7(9)10/h5,8H,1-4H2 |
| InChIKey | FJNKRDIIGGJSFA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitropiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitropiperidin-4-ol?
The IUPAC name of 1-nitropiperidin-4-ol (CID 141406661) is 1-nitropiperidin-4-ol.
What is the SMILES notation for 1-nitropiperidin-4-ol?
The canonical SMILES for 1-nitropiperidin-4-ol is O=[N+]([O-])N1CCC(O)CC1.
What is the InChIKey of 1-nitropiperidin-4-ol?
The InChIKey is FJNKRDIIGGJSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c8-5-1-3-6(4-2-5)7(9)10/h5,8H,1-4H2.
What are the key properties of 1-nitropiperidin-4-ol?
1-nitropiperidin-4-ol has a molecular weight of 146.15 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitropiperidin-4-ol is sourced from PubChem (CID 141406661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).