About 1-nitroazetidin-3-ol
1-nitroazetidin-3-ol (PubChem CID 10701814) has the molecular formula C3H6N2O3
and a molecular weight of 118.09 g/mol. Its IUPAC name is 1-nitroazetidin-3-ol.
Molecular Properties
| Compound Name | 1-nitroazetidin-3-ol |
| PubChem CID | 10701814 |
| Molecular Formula | C3H6N2O3 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 1-nitroazetidin-3-ol |
| SMILES | O=[N+]([O-])N1CC(O)C1 |
| InChI | InChI=1S/C3H6N2O3/c6-3-1-4(2-3)5(7)8/h3,6H,1-2H2 |
| InChIKey | CZMOGEXCDFYJGV-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroazetidin-3-ol?
The IUPAC name of 1-nitroazetidin-3-ol (CID 10701814) is 1-nitroazetidin-3-ol.
What is the SMILES notation for 1-nitroazetidin-3-ol?
The canonical SMILES for 1-nitroazetidin-3-ol is O=[N+]([O-])N1CC(O)C1.
What is the InChIKey of 1-nitroazetidin-3-ol?
The InChIKey is CZMOGEXCDFYJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O3/c6-3-1-4(2-3)5(7)8/h3,6H,1-2H2.
What are the key properties of 1-nitroazetidin-3-ol?
1-nitroazetidin-3-ol has a molecular weight of 118.09 g/mol, XLogP of -1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroazetidin-3-ol is sourced from PubChem (CID 10701814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).