C4H8N8O7 — CID 21093324
1,3,5-trinitro-7-nitroso-1,3,5,7-tetrazocane (PubChem CID 21093324) has the molecular formula C4H8N8O7 and a molecular weight of 280.16 g/mol. Its IUPAC name is 1,3,5-trinitro-7-nitroso-1,3,5,7-tetrazocane.
| Compound Name | 1,3,5-trinitro-7-nitroso-1,3,5,7-tetrazocane |
|---|---|
| PubChem CID | 21093324 |
| Molecular Formula | C4H8N8O7 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1,3,5-trinitro-7-nitroso-1,3,5,7-tetrazocane |
| SMILES | O=NN1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C4H8N8O7/c13-5-6-1-7(10(14)15)3-9(12(18)19)4-8(2-6)11(16)17/h1-4H2 |
| InChIKey | CLKLNZQZAYTILU-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 171.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|