C3H10N6O — CID 89064293
5-nitroso-1,3,5-triazinane-1,3-diamine (PubChem CID 89064293) has the molecular formula C3H10N6O and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-nitroso-1,3,5-triazinane-1,3-diamine.
| Compound Name | 5-nitroso-1,3,5-triazinane-1,3-diamine |
|---|---|
| PubChem CID | 89064293 |
| Molecular Formula | C3H10N6O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 5-nitroso-1,3,5-triazinane-1,3-diamine |
| SMILES | NN1CN(N)CN(N=O)C1 |
| InChI | InChI=1S/C3H10N6O/c4-7-1-8(5)3-9(2-7)6-10/h1-5H2 |
| InChIKey | DJGASVDFSQEGDD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|