About 5-nitroso-1,3,5-triazinane-1,3-diamine
5-nitroso-1,3,5-triazinane-1,3-diamine (PubChem CID 89064293) has the molecular formula C3H10N6O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-nitroso-1,3,5-triazinane-1,3-diamine.
Molecular Properties
| Compound Name | 5-nitroso-1,3,5-triazinane-1,3-diamine |
| PubChem CID | 89064293 |
| Molecular Formula | C3H10N6O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 5-nitroso-1,3,5-triazinane-1,3-diamine |
| SMILES | NN1CN(N)CN(N=O)C1 |
| InChI | InChI=1S/C3H10N6O/c4-7-1-8(5)3-9(2-7)6-10/h1-5H2 |
| InChIKey | DJGASVDFSQEGDD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 5-nitroso-1,3,5-triazinane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitroso-1,3,5-triazinane-1,3-diamine?
The IUPAC name of 5-nitroso-1,3,5-triazinane-1,3-diamine (CID 89064293) is 5-nitroso-1,3,5-triazinane-1,3-diamine.
What is the SMILES notation for 5-nitroso-1,3,5-triazinane-1,3-diamine?
The canonical SMILES for 5-nitroso-1,3,5-triazinane-1,3-diamine is NN1CN(N)CN(N=O)C1.
What is the InChIKey of 5-nitroso-1,3,5-triazinane-1,3-diamine?
The InChIKey is DJGASVDFSQEGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N6O/c4-7-1-8(5)3-9(2-7)6-10/h1-5H2.
What are the key properties of 5-nitroso-1,3,5-triazinane-1,3-diamine?
5-nitroso-1,3,5-triazinane-1,3-diamine has a molecular weight of 146.15 g/mol, XLogP of -1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitroso-1,3,5-triazinane-1,3-diamine is sourced from PubChem (CID 89064293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).