About 1-nitroimidazolidine
1-nitroimidazolidine (PubChem CID 22048141) has the molecular formula C3H7N3O2
and a molecular weight of 117.11 g/mol. Its IUPAC name is 1-nitroimidazolidine.
Molecular Properties
| Compound Name | 1-nitroimidazolidine |
| PubChem CID | 22048141 |
| Molecular Formula | C3H7N3O2 |
| Molecular Weight | 117.11 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | 1-nitroimidazolidine |
| SMILES | O=[N+]([O-])N1CCNC1 |
| InChI | InChI=1S/C3H7N3O2/c7-6(8)5-2-1-4-3-5/h4H,1-3H2 |
| InChIKey | GFIAJRZTXFCNFT-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.11 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroimidazolidine?
The IUPAC name of 1-nitroimidazolidine (CID 22048141) is 1-nitroimidazolidine.
What is the SMILES notation for 1-nitroimidazolidine?
The canonical SMILES for 1-nitroimidazolidine is O=[N+]([O-])N1CCNC1.
What is the InChIKey of 1-nitroimidazolidine?
The InChIKey is GFIAJRZTXFCNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O2/c7-6(8)5-2-1-4-3-5/h4H,1-3H2.
What are the key properties of 1-nitroimidazolidine?
1-nitroimidazolidine has a molecular weight of 117.11 g/mol, XLogP of -0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroimidazolidine is sourced from PubChem (CID 22048141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).