About 2-methyl-1,4-dinitropiperazine
2-methyl-1,4-dinitropiperazine (PubChem CID 53424650) has the molecular formula C5H10N4O4
and a molecular weight of 190.16 g/mol. Its IUPAC name is 2-methyl-1,4-dinitropiperazine.
Molecular Properties
| Compound Name | 2-methyl-1,4-dinitropiperazine |
| PubChem CID | 53424650 |
| Molecular Formula | C5H10N4O4 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-methyl-1,4-dinitropiperazine |
| SMILES | CC1CN([N+](=O)[O-])CCN1[N+](=O)[O-] |
| InChI | InChI=1S/C5H10N4O4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h5H,2-4H2,1H3 |
| InChIKey | ITUQKUDXWSCSIM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,4-dinitropiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-dinitropiperazine?
The IUPAC name of 2-methyl-1,4-dinitropiperazine (CID 53424650) is 2-methyl-1,4-dinitropiperazine.
What is the SMILES notation for 2-methyl-1,4-dinitropiperazine?
The canonical SMILES for 2-methyl-1,4-dinitropiperazine is CC1CN([N+](=O)[O-])CCN1[N+](=O)[O-].
What is the InChIKey of 2-methyl-1,4-dinitropiperazine?
The InChIKey is ITUQKUDXWSCSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h5H,2-4H2,1H3.
What are the key properties of 2-methyl-1,4-dinitropiperazine?
2-methyl-1,4-dinitropiperazine has a molecular weight of 190.16 g/mol, XLogP of -0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-dinitropiperazine is sourced from PubChem (CID 53424650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).