C5H9N9O12 — CID 174864696
1,1,1-trinitroethane;1,3,5-trinitro-1,3,5-triazinane (PubChem CID 174864696) has the molecular formula C5H9N9O12 and a molecular weight of 387.18 g/mol. Its IUPAC name is 1,1,1-trinitroethane;1,3,5-trinitro-1,3,5-triazinane.
| Compound Name | 1,1,1-trinitroethane;1,3,5-trinitro-1,3,5-triazinane |
|---|---|
| PubChem CID | 174864696 |
| Molecular Formula | C5H9N9O12 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1,1,1-trinitroethane;1,3,5-trinitro-1,3,5-triazinane |
| SMILES | CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C3H6N6O6.C2H3N3O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;1-2(3(6)7,4(8)9)5(10)11/h1-3H2;1H3 |
| InChIKey | UITHPLJVGWJYLD-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 268.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|