About nitromethane;hydroiodide
nitromethane;hydroiodide (PubChem CID 159753263) has the molecular formula CH4INO2
and a molecular weight of 188.95 g/mol. Its IUPAC name is nitromethane;hydroiodide.
Molecular Properties
| Compound Name | nitromethane;hydroiodide |
| PubChem CID | 159753263 |
| Molecular Formula | CH4INO2 |
| Molecular Weight | 188.95 g/mol |
| Exact Mass | 188.93 |
| IUPAC Name | nitromethane;hydroiodide |
| SMILES | C[N+](=O)[O-].I |
| InChI | InChI=1S/CH3NO2.HI/c1-2(3)4;/h1H3;1H |
| InChIKey | TXUZDHFVBBCYGN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.95 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitromethane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitromethane;hydroiodide?
The IUPAC name of nitromethane;hydroiodide (CID 159753263) is nitromethane;hydroiodide.
What is the SMILES notation for nitromethane;hydroiodide?
The canonical SMILES for nitromethane;hydroiodide is C[N+](=O)[O-].I.
What is the InChIKey of nitromethane;hydroiodide?
The InChIKey is TXUZDHFVBBCYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.HI/c1-2(3)4;/h1H3;1H.
What are the key properties of nitromethane;hydroiodide?
nitromethane;hydroiodide has a molecular weight of 188.95 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitromethane;hydroiodide is sourced from PubChem (CID 159753263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).