C15H33N7 — CID 102300822
1,4,7,9,11,14,19-heptazatricyclo[7.7.4.24,14]docosane (PubChem CID 102300822) has the molecular formula C15H33N7 and a molecular weight of 311.48 g/mol. Its IUPAC name is 1,4,7,9,11,14,19-heptazatricyclo[7.7.4.24,14]docosane.
| Compound Name | 1,4,7,9,11,14,19-heptazatricyclo[7.7.4.24,14]docosane |
|---|---|
| PubChem CID | 102300822 |
| Molecular Formula | C15H33N7 |
| Molecular Weight | 311.48 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | 1,4,7,9,11,14,19-heptazatricyclo[7.7.4.24,14]docosane |
| SMILES | C1CN2CCN3CCNCN(CN1)CNCCN(CC2)CC3 |
| InChI | InChI=1S/C15H33N7/c1-4-19-7-9-20-5-2-17-14-22(13-16-1)15-18-3-6-21(10-8-19)12-11-20/h16-18H,1-15H2 |
| InChIKey | JNOKGQLTAHMWIJ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 49.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.48 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |