C14H30N4 — CID 6396556
1,4,8,11-tetrazabicyclo[9.5.2]octadecane (PubChem CID 6396556) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1,4,8,11-tetrazabicyclo[9.5.2]octadecane.
| Compound Name | 1,4,8,11-tetrazabicyclo[9.5.2]octadecane |
|---|---|
| PubChem CID | 6396556 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 1,4,8,11-tetrazabicyclo[9.5.2]octadecane |
| SMILES | C1CCN2CCNCCCNCCN(CC1)CC2 |
| InChI | InChI=1S/C14H30N4/c1-2-9-17-11-7-15-5-4-6-16-8-12-18(10-3-1)14-13-17/h15-16H,1-14H2 |
| InChIKey | WMQLBBDUGAKHRQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |