C32H52N8 — CID 10697879
1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene (PubChem CID 10697879) has the molecular formula C32H52N8 and a molecular weight of 548.82 g/mol. Its IUPAC name is 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene.
| Compound Name | 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene |
|---|---|
| PubChem CID | 10697879 |
| Molecular Formula | C32H52N8 |
| Molecular Weight | 548.82 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene |
| SMILES | c1cc2ccc1CN1CCNCCN(CCNCC1)Cc1ccc(cc1)CN1CCNCCN(CCNCC1)C2 |
| InChI | InChI=1S/C32H52N8/c1-2-30-4-3-29(1)25-37-17-9-33-13-21-39(22-14-34-10-18-37)27-31-5-7-32(8-6-31)28-40-23-15-35-11-19-38(26-30)20-12-36-16-24-40/h1-8,33-36H,9-28H2 |
| InChIKey | GYKFYABYPGKUKT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.82 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |