C16H26N6 — CID 142148014
1,8,11,14,17,22-hexazatetracyclo[15.2.1.13,6.18,11]docosa-3,5,9-triene (PubChem CID 142148014) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 1,8,11,14,17,22-hexazatetracyclo[15.2.1.13,6.18,11]docosa-3,5,9-triene.
| Compound Name | 1,8,11,14,17,22-hexazatetracyclo[15.2.1.13,6.18,11]docosa-3,5,9-triene |
|---|---|
| PubChem CID | 142148014 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1,8,11,14,17,22-hexazatetracyclo[15.2.1.13,6.18,11]docosa-3,5,9-triene |
| SMILES | C1=CN2Cc3ccc([nH]3)CN3CCN(CCNCCN1C2)C3 |
| InChI | InChI=1S/C16H26N6/c1-2-16-12-22-10-8-20(14-22)6-4-17-3-5-19-7-9-21(13-19)11-15(1)18-16/h1-2,7,9,17-18H,3-6,8,10-14H2 |
| InChIKey | QPPCZABADMSHQK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 40.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |