C24H26N6 — CID 90800297
1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-3,5,8,10,13,15,18,20,24-nonaene (PubChem CID 90800297) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-3,5,8,10,13,15,18,20,24-nonaene.
| Compound Name | 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-3,5,8,10,13,15,18,20,24-nonaene |
|---|---|
| PubChem CID | 90800297 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-3,5,8,10,13,15,18,20,24-nonaene |
| SMILES | C1=CN2Cc3ccc([nH]3)Cc3ccc([nH]3)Cc3ccc([nH]3)Cc3ccc([nH]3)CN1C2 |
| InChI | InChI=1S/C24H26N6/c1-3-19-12-21-5-7-23(27-21)14-29-9-10-30(16-29)15-24-8-6-22(28-24)13-20-4-2-18(26-20)11-17(1)25-19/h1-10,25-28H,11-16H2 |
| InChIKey | NECRYSHKWQROLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |