C26H43N9 — CID 102314844
1,5,7,11,15,17,21,24,29-nonazatetracyclo[19.5.5.23,6.216,19]pentatriaconta-3,5,16,18,32,34-hexaene (PubChem CID 102314844) has the molecular formula C26H43N9 and a molecular weight of 481.69 g/mol. Its IUPAC name is 1,5,7,11,15,17,21,24,29-nonazatetracyclo[19.5.5.23,6.216,19]pentatriaconta-3,5,16,18,32,34-hexaene.
| Compound Name | 1,5,7,11,15,17,21,24,29-nonazatetracyclo[19.5.5.23,6.216,19]pentatriaconta-3,5,16,18,32,34-hexaene |
|---|---|
| PubChem CID | 102314844 |
| Molecular Formula | C26H43N9 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 1,5,7,11,15,17,21,24,29-nonazatetracyclo[19.5.5.23,6.216,19]pentatriaconta-3,5,16,18,32,34-hexaene |
| SMILES | c1cc2ncc1CN1CCNCCN(CCNCC1)Cc1ccc(nc1)NCCCNCCCN2 |
| InChI | InChI=1S/C26H43N9/c1-7-27-8-2-10-31-26-6-4-24(20-33-26)22-35-17-13-28-11-15-34(16-12-29-14-18-35)21-23-3-5-25(30-9-1)32-19-23/h3-6,19-20,27-29H,1-2,7-18,21-22H2,(H,30,32)(H,31,33) |
| InChIKey | AXAMDWHWSHILLH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |