C12H18N4 — CID 50998845
8-piperazin-1-yl-1,2,3,4-tetrahydro-1,7-naphthyridine (PubChem CID 50998845) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-piperazin-1-yl-1,2,3,4-tetrahydro-1,7-naphthyridine.
| Compound Name | 8-piperazin-1-yl-1,2,3,4-tetrahydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 50998845 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 8-piperazin-1-yl-1,2,3,4-tetrahydro-1,7-naphthyridine |
| SMILES | c1cc2c(c(N3CCNCC3)n1)NCCC2 |
| InChI | InChI=1S/C12H18N4/c1-2-10-3-5-15-12(11(10)14-4-1)16-8-6-13-7-9-16/h3,5,13-14H,1-2,4,6-9H2 |
| InChIKey | OYOCEAGGKZOLOY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |