C11H15N5 — CID 84683022
3-methyl-4-piperazin-1-ylimidazo[4,5-c]pyridine (PubChem CID 84683022) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-methyl-4-piperazin-1-ylimidazo[4,5-c]pyridine.
| Compound Name | 3-methyl-4-piperazin-1-ylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 84683022 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-methyl-4-piperazin-1-ylimidazo[4,5-c]pyridine |
| SMILES | Cn1cnc2ccnc(N3CCNCC3)c21 |
| InChI | InChI=1S/C11H15N5/c1-15-8-14-9-2-3-13-11(10(9)15)16-6-4-12-5-7-16/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | HGMFUXURBAJTBY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |