About 1-methylbenzimidazole;pyrrolidine
1-methylbenzimidazole;pyrrolidine (PubChem CID 174527283) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-methylbenzimidazole;pyrrolidine.
Molecular Properties
| Compound Name | 1-methylbenzimidazole;pyrrolidine |
| PubChem CID | 174527283 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-methylbenzimidazole;pyrrolidine |
| SMILES | C1CCNC1.Cn1cnc2ccccc21 |
| InChI | InChI=1S/C8H8N2.C4H9N/c1-10-6-9-7-4-2-3-5-8(7)10;1-2-4-5-3-1/h2-6H,1H3;5H,1-4H2 |
| InChIKey | CEROFIZKWPYWAH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylbenzimidazole;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzimidazole;pyrrolidine?
The IUPAC name of 1-methylbenzimidazole;pyrrolidine (CID 174527283) is 1-methylbenzimidazole;pyrrolidine.
What is the SMILES notation for 1-methylbenzimidazole;pyrrolidine?
The canonical SMILES for 1-methylbenzimidazole;pyrrolidine is C1CCNC1.Cn1cnc2ccccc21.
What is the InChIKey of 1-methylbenzimidazole;pyrrolidine?
The InChIKey is CEROFIZKWPYWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H9N/c1-10-6-9-7-4-2-3-5-8(7)10;1-2-4-5-3-1/h2-6H,1H3;5H,1-4H2.
What are the key properties of 1-methylbenzimidazole;pyrrolidine?
1-methylbenzimidazole;pyrrolidine has a molecular weight of 203.29 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzimidazole;pyrrolidine is sourced from PubChem (CID 174527283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).