About 1-methylbenzimidazole;propane
1-methylbenzimidazole;propane (PubChem CID 91130597) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-methylbenzimidazole;propane.
Molecular Properties
| Compound Name | 1-methylbenzimidazole;propane |
| PubChem CID | 91130597 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-methylbenzimidazole;propane |
| SMILES | CCC.Cn1cnc2ccccc21 |
| InChI | InChI=1S/C8H8N2.C3H8/c1-10-6-9-7-4-2-3-5-8(7)10;1-3-2/h2-6H,1H3;3H2,1-2H3 |
| InChIKey | HNVRNDQXPMRQDI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylbenzimidazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzimidazole;propane?
The IUPAC name of 1-methylbenzimidazole;propane (CID 91130597) is 1-methylbenzimidazole;propane.
What is the SMILES notation for 1-methylbenzimidazole;propane?
The canonical SMILES for 1-methylbenzimidazole;propane is CCC.Cn1cnc2ccccc21.
What is the InChIKey of 1-methylbenzimidazole;propane?
The InChIKey is HNVRNDQXPMRQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C3H8/c1-10-6-9-7-4-2-3-5-8(7)10;1-3-2/h2-6H,1H3;3H2,1-2H3.
What are the key properties of 1-methylbenzimidazole;propane?
1-methylbenzimidazole;propane has a molecular weight of 176.26 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzimidazole;propane is sourced from PubChem (CID 91130597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).