About 1-methylbenzimidazole;morpholine
1-methylbenzimidazole;morpholine (PubChem CID 178060017) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-methylbenzimidazole;morpholine.
Molecular Properties
| Compound Name | 1-methylbenzimidazole;morpholine |
| PubChem CID | 178060017 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-methylbenzimidazole;morpholine |
| SMILES | C1COCCN1.Cn1cnc2ccccc21 |
| InChI | InChI=1S/C8H8N2.C4H9NO/c1-10-6-9-7-4-2-3-5-8(7)10;1-3-6-4-2-5-1/h2-6H,1H3;5H,1-4H2 |
| InChIKey | OAGCVFJZNHKVHR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylbenzimidazole;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylbenzimidazole;morpholine?
The IUPAC name of 1-methylbenzimidazole;morpholine (CID 178060017) is 1-methylbenzimidazole;morpholine.
What is the SMILES notation for 1-methylbenzimidazole;morpholine?
The canonical SMILES for 1-methylbenzimidazole;morpholine is C1COCCN1.Cn1cnc2ccccc21.
What is the InChIKey of 1-methylbenzimidazole;morpholine?
The InChIKey is OAGCVFJZNHKVHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H9NO/c1-10-6-9-7-4-2-3-5-8(7)10;1-3-6-4-2-5-1/h2-6H,1H3;5H,1-4H2.
What are the key properties of 1-methylbenzimidazole;morpholine?
1-methylbenzimidazole;morpholine has a molecular weight of 219.29 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylbenzimidazole;morpholine is sourced from PubChem (CID 178060017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).