C12H16N4 — CID 57095230
1-(1,4-diazepan-1-yl)benzimidazole (PubChem CID 57095230) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)benzimidazole.
| Compound Name | 1-(1,4-diazepan-1-yl)benzimidazole |
|---|---|
| PubChem CID | 57095230 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)benzimidazole |
| SMILES | c1ccc2c(c1)ncn2N1CCCNCC1 |
| InChI | InChI=1S/C12H16N4/c1-2-5-12-11(4-1)14-10-16(12)15-8-3-6-13-7-9-15/h1-2,4-5,10,13H,3,6-9H2 |
| InChIKey | YAIZOJVSOXUWPT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |