About CID 172839062
CID 172839062 (PubChem CID 172839062) has the molecular formula C8H8N2Na
and a molecular weight of 155.16 g/mol.
Molecular Properties
| Compound Name | CID 172839062 |
| PubChem CID | 172839062 |
| Molecular Formula | C8H8N2Na |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | — |
| SMILES | Cn1cnc2ccccc21.[Na] |
| InChI | InChI=1S/C8H8N2.Na/c1-10-6-9-7-4-2-3-5-8(7)10;/h2-6H,1H3; |
| InChIKey | WNYJSONDCGUGIK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 172839062 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172839062?
The IUPAC name of CID 172839062 (CID 172839062) is not available.
What is the SMILES notation for CID 172839062?
The canonical SMILES for CID 172839062 is Cn1cnc2ccccc21.[Na].
What is the InChIKey of CID 172839062?
The InChIKey is WNYJSONDCGUGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.Na/c1-10-6-9-7-4-2-3-5-8(7)10;/h2-6H,1H3;.
What are the key properties of CID 172839062?
CID 172839062 has a molecular weight of 155.16 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172839062 is sourced from PubChem (CID 172839062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).