C13H20N2 — CID 167554382
2,2-dimethylpropane;1-methylbenzimidazole (PubChem CID 167554382) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2,2-dimethylpropane;1-methylbenzimidazole.
| Compound Name | 2,2-dimethylpropane;1-methylbenzimidazole |
|---|---|
| PubChem CID | 167554382 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2,2-dimethylpropane;1-methylbenzimidazole |
| SMILES | CC(C)(C)C.Cn1cnc2ccccc21 |
| InChI | InChI=1S/C8H8N2.C5H12/c1-10-6-9-7-4-2-3-5-8(7)10;1-5(2,3)4/h2-6H,1H3;1-4H3 |
| InChIKey | CUXJOEUSUSSNHR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |