About 1-hydroxybenzimidazole;hydrate
1-hydroxybenzimidazole;hydrate (PubChem CID 22048229) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1-hydroxybenzimidazole;hydrate.
Molecular Properties
| Compound Name | 1-hydroxybenzimidazole;hydrate |
| PubChem CID | 22048229 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 1-hydroxybenzimidazole;hydrate |
| SMILES | O.On1cnc2ccccc21 |
| InChI | InChI=1S/C7H6N2O.H2O/c10-9-5-8-6-3-1-2-4-7(6)9;/h1-5,10H;1H2 |
| InChIKey | KHPHNSRBACPNOZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxybenzimidazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxybenzimidazole;hydrate?
The IUPAC name of 1-hydroxybenzimidazole;hydrate (CID 22048229) is 1-hydroxybenzimidazole;hydrate.
What is the SMILES notation for 1-hydroxybenzimidazole;hydrate?
The canonical SMILES for 1-hydroxybenzimidazole;hydrate is O.On1cnc2ccccc21.
What is the InChIKey of 1-hydroxybenzimidazole;hydrate?
The InChIKey is KHPHNSRBACPNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.H2O/c10-9-5-8-6-3-1-2-4-7(6)9;/h1-5,10H;1H2.
What are the key properties of 1-hydroxybenzimidazole;hydrate?
1-hydroxybenzimidazole;hydrate has a molecular weight of 152.15 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxybenzimidazole;hydrate is sourced from PubChem (CID 22048229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).