About bis(benzimidazol-1-yl) carbonate
bis(benzimidazol-1-yl) carbonate (PubChem CID 57193653) has the molecular formula C15H10N4O3
and a molecular weight of 294.27 g/mol. Its IUPAC name is bis(benzimidazol-1-yl) carbonate.
Molecular Properties
| Compound Name | bis(benzimidazol-1-yl) carbonate |
| PubChem CID | 57193653 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | bis(benzimidazol-1-yl) carbonate |
| SMILES | O=C(On1cnc2ccccc21)On1cnc2ccccc21 |
| InChI | InChI=1S/C15H10N4O3/c20-15(21-18-9-16-11-5-1-3-7-13(11)18)22-19-10-17-12-6-2-4-8-14(12)19/h1-10H |
| InChIKey | PDMGUVKYHPZJHH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(benzimidazol-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzimidazol-1-yl) carbonate?
The IUPAC name of bis(benzimidazol-1-yl) carbonate (CID 57193653) is bis(benzimidazol-1-yl) carbonate.
What is the SMILES notation for bis(benzimidazol-1-yl) carbonate?
The canonical SMILES for bis(benzimidazol-1-yl) carbonate is O=C(On1cnc2ccccc21)On1cnc2ccccc21.
What is the InChIKey of bis(benzimidazol-1-yl) carbonate?
The InChIKey is PDMGUVKYHPZJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O3/c20-15(21-18-9-16-11-5-1-3-7-13(11)18)22-19-10-17-12-6-2-4-8-14(12)19/h1-10H.
What are the key properties of bis(benzimidazol-1-yl) carbonate?
bis(benzimidazol-1-yl) carbonate has a molecular weight of 294.27 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzimidazol-1-yl) carbonate is sourced from PubChem (CID 57193653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).