C19H16N4O2 — CID 15564125
ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate (PubChem CID 15564125) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate.
| Compound Name | ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 15564125 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=C(n1cnc2ccccc21)n1cnc2ccccc21 |
| InChI | InChI=1S/C19H16N4O2/c1-2-25-19(24)11-18(22-12-20-14-7-3-5-9-16(14)22)23-13-21-15-8-4-6-10-17(15)23/h3-13H,2H2,1H3 |
| InChIKey | IGXCWDYDKRCDFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|