ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate

C19H16N4O2 — CID 15564125

IUPACethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate
SMILESCCOC(=O)C=C(n1cnc2ccccc21)n1cnc2ccccc21
InChIInChI=1S/C19H16N4O2/c1-2-25-19(24)11-18(22-12-20-14-7-3-5-9-16(14)22)23-13-21-15-8-4-6-10-17(15)23/h3-13H,2H2,1H3
InChIKeyIGXCWDYDKRCDFY-UHFFFAOYSA-N
MW332.36 g/mol
LogP3.11
Rot. Bonds4

About ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate

ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate (PubChem CID 15564125) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate.

Molecular Properties

Compound Nameethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate
PubChem CID15564125
Molecular FormulaC19H16N4O2
Molecular Weight332.36 g/mol
Exact Mass332.13
IUPAC Nameethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate
SMILESCCOC(=O)C=C(n1cnc2ccccc21)n1cnc2ccccc21
InChIInChI=1S/C19H16N4O2/c1-2-25-19(24)11-18(22-12-20-14-7-3-5-9-16(14)22)23-13-21-15-8-4-6-10-17(15)23/h3-13H,2H2,1H3
InChIKeyIGXCWDYDKRCDFY-UHFFFAOYSA-N
XLogP3.11
TPSA61.94 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.36
LogP ≤ 53.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate?
The IUPAC name of ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate (CID 15564125) is ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate.
What is the SMILES notation for ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate?
The canonical SMILES for ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate is CCOC(=O)C=C(n1cnc2ccccc21)n1cnc2ccccc21.
What is the InChIKey of ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate?
The InChIKey is IGXCWDYDKRCDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-2-25-19(24)11-18(22-12-20-14-7-3-5-9-16(14)22)23-13-21-15-8-4-6-10-17(15)23/h3-13H,2H2,1H3.
What are the key properties of ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate?
ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate has a molecular weight of 332.36 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-bis(benzimidazol-1-yl)prop-2-enoate is sourced from PubChem (CID 15564125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).