C11H14N2 — CID 145318091
1,5-dimethylbenzimidazole;ethene (PubChem CID 145318091) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,5-dimethylbenzimidazole;ethene.
| Compound Name | 1,5-dimethylbenzimidazole;ethene |
|---|---|
| PubChem CID | 145318091 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,5-dimethylbenzimidazole;ethene |
| SMILES | C=C.Cc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C9H10N2.C2H4/c1-7-3-4-9-8(5-7)10-6-11(9)2;1-2/h3-6H,1-2H3;1-2H2 |
| InChIKey | HGLGFJOXVATICR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|