About 1,3-diethylbenzene;1,5-dimethylbenzimidazole
1,3-diethylbenzene;1,5-dimethylbenzimidazole (PubChem CID 143832422) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 1,3-diethylbenzene;1,5-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1,3-diethylbenzene;1,5-dimethylbenzimidazole |
| PubChem CID | 143832422 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1,3-diethylbenzene;1,5-dimethylbenzimidazole |
| SMILES | CCc1cccc(CC)c1.Cc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C10H14.C9H10N2/c1-3-9-6-5-7-10(4-2)8-9;1-7-3-4-9-8(5-7)10-6-11(9)2/h5-8H,3-4H2,1-2H3;3-6H,1-2H3 |
| InChIKey | XQUYMXKNOJBCSA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diethylbenzene;1,5-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethylbenzene;1,5-dimethylbenzimidazole?
The IUPAC name of 1,3-diethylbenzene;1,5-dimethylbenzimidazole (CID 143832422) is 1,3-diethylbenzene;1,5-dimethylbenzimidazole.
What is the SMILES notation for 1,3-diethylbenzene;1,5-dimethylbenzimidazole?
The canonical SMILES for 1,3-diethylbenzene;1,5-dimethylbenzimidazole is CCc1cccc(CC)c1.Cc1ccc2c(c1)ncn2C.
What is the InChIKey of 1,3-diethylbenzene;1,5-dimethylbenzimidazole?
The InChIKey is XQUYMXKNOJBCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C9H10N2/c1-3-9-6-5-7-10(4-2)8-9;1-7-3-4-9-8(5-7)10-6-11(9)2/h5-8H,3-4H2,1-2H3;3-6H,1-2H3.
What are the key properties of 1,3-diethylbenzene;1,5-dimethylbenzimidazole?
1,3-diethylbenzene;1,5-dimethylbenzimidazole has a molecular weight of 280.42 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethylbenzene;1,5-dimethylbenzimidazole is sourced from PubChem (CID 143832422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).