About 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole
4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole (PubChem CID 178060103) has the molecular formula C19H21ClFN3O
and a molecular weight of 361.85 g/mol. Its IUPAC name is 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole.
Molecular Properties
| Compound Name | 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole |
| PubChem CID | 178060103 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole |
| SMILES | Cn1cnc2ccccc21.Fc1cc(CN2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C11H13ClFNO.C8H8N2/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14;1-10-6-9-7-4-2-3-5-8(7)10/h1-2,7H,3-6,8H2;2-6H,1H3 |
| InChIKey | VVNDRSZMGVTOKD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole?
The IUPAC name of 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole (CID 178060103) is 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole.
What is the SMILES notation for 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole?
The canonical SMILES for 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole is Cn1cnc2ccccc21.Fc1cc(CN2CCOCC2)ccc1Cl.
What is the InChIKey of 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole?
The InChIKey is VVNDRSZMGVTOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClFNO.C8H8N2/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14;1-10-6-9-7-4-2-3-5-8(7)10/h1-2,7H,3-6,8H2;2-6H,1H3.
What are the key properties of 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole?
4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole has a molecular weight of 361.85 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-3-fluorophenyl)methyl]morpholine;1-methylbenzimidazole is sourced from PubChem (CID 178060103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).