C22H27N3O5 — CID 172896679
4-[[3-[2-(benzimidazol-1-yl)ethoxy]-4-methoxyphenyl]methyl]morpholine;formic acid (PubChem CID 172896679) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-[[3-[2-(benzimidazol-1-yl)ethoxy]-4-methoxyphenyl]methyl]morpholine;formic acid.
| Compound Name | 4-[[3-[2-(benzimidazol-1-yl)ethoxy]-4-methoxyphenyl]methyl]morpholine;formic acid |
|---|---|
| PubChem CID | 172896679 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-[[3-[2-(benzimidazol-1-yl)ethoxy]-4-methoxyphenyl]methyl]morpholine;formic acid |
| SMILES | COc1ccc(CN2CCOCC2)cc1OCCn1cnc2ccccc21.O=CO |
| InChI | InChI=1S/C21H25N3O3.CH2O2/c1-25-20-7-6-17(15-23-8-11-26-12-9-23)14-21(20)27-13-10-24-16-22-18-4-2-3-5-19(18)24;2-1-3/h2-7,14,16H,8-13,15H2,1H3;1H,(H,2,3) |
| InChIKey | OQDVXPFZYVWBKH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|