About 2-methylphenazine;morpholine
2-methylphenazine;morpholine (PubChem CID 175101358) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-methylphenazine;morpholine.
Molecular Properties
| Compound Name | 2-methylphenazine;morpholine |
| PubChem CID | 175101358 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-methylphenazine;morpholine |
| SMILES | C1COCCN1.Cc1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C13H10N2.C4H9NO/c1-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12;1-3-6-4-2-5-1/h2-8H,1H3;5H,1-4H2 |
| InChIKey | LMQPJWIXKDZKIT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylphenazine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenazine;morpholine?
The IUPAC name of 2-methylphenazine;morpholine (CID 175101358) is 2-methylphenazine;morpholine.
What is the SMILES notation for 2-methylphenazine;morpholine?
The canonical SMILES for 2-methylphenazine;morpholine is C1COCCN1.Cc1ccc2nc3ccccc3nc2c1.
What is the InChIKey of 2-methylphenazine;morpholine?
The InChIKey is LMQPJWIXKDZKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.C4H9NO/c1-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12;1-3-6-4-2-5-1/h2-8H,1H3;5H,1-4H2.
What are the key properties of 2-methylphenazine;morpholine?
2-methylphenazine;morpholine has a molecular weight of 281.36 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenazine;morpholine is sourced from PubChem (CID 175101358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).