C14H20N2O — CID 174829354
6-methyl-3,4-dihydroquinoline;morpholine (PubChem CID 174829354) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-methyl-3,4-dihydroquinoline;morpholine.
| Compound Name | 6-methyl-3,4-dihydroquinoline;morpholine |
|---|---|
| PubChem CID | 174829354 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-methyl-3,4-dihydroquinoline;morpholine |
| SMILES | C1COCCN1.Cc1ccc2c(c1)CCC=N2 |
| InChI | InChI=1S/C10H11N.C4H9NO/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-3-6-4-2-5-1/h4-7H,2-3H2,1H3;5H,1-4H2 |
| InChIKey | UHVIHYWVKZBTRF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |