C16H17N — CID 90774694
6-(3-methylcyclohexa-2,4-dien-1-yl)-3,4-dihydroquinoline (PubChem CID 90774694) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-(3-methylcyclohexa-2,4-dien-1-yl)-3,4-dihydroquinoline.
| Compound Name | 6-(3-methylcyclohexa-2,4-dien-1-yl)-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 90774694 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 6-(3-methylcyclohexa-2,4-dien-1-yl)-3,4-dihydroquinoline |
| SMILES | CC1=CC(c2ccc3c(c2)CCC=N3)CC=C1 |
| InChI | InChI=1S/C16H17N/c1-12-4-2-5-13(10-12)14-7-8-16-15(11-14)6-3-9-17-16/h2,4,7-11,13H,3,5-6H2,1H3 |
| InChIKey | DRLZKLCKEIGMKR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |