C18H23O3P — CID 126491615
2-ethoxy-3,3-dimethyl-6-(3-methylcyclohexa-2,4-dien-1-yl)-1,2λ5-benzoxaphosphole 2-oxide (PubChem CID 126491615) has the molecular formula C18H23O3P and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-6-(3-methylcyclohexa-2,4-dien-1-yl)-1,2λ5-benzoxaphosphole 2-oxide.
| Compound Name | 2-ethoxy-3,3-dimethyl-6-(3-methylcyclohexa-2,4-dien-1-yl)-1,2λ5-benzoxaphosphole 2-oxide |
|---|---|
| PubChem CID | 126491615 |
| Molecular Formula | C18H23O3P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-6-(3-methylcyclohexa-2,4-dien-1-yl)-1,2λ5-benzoxaphosphole 2-oxide |
| SMILES | CCOP1(=O)Oc2cc(C3C=C(C)C=CC3)ccc2C1(C)C |
| InChI | InChI=1S/C18H23O3P/c1-5-20-22(19)18(3,4)16-10-9-15(12-17(16)21-22)14-8-6-7-13(2)11-14/h6-7,9-12,14H,5,8H2,1-4H3 |
| InChIKey | GPUJCCURTBSFID-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|