About 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride
6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride (PubChem CID 144964238) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride.
Analyze 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride?
The IUPAC name of 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride (CID 144964238) is 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride.
What is the SMILES notation for 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride?
The canonical SMILES for 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride is COC1C=C(C)C=CC1.Cl.
What is the InChIKey of 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride?
The InChIKey is SSEPSQXCADBMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.ClH/c1-7-4-3-5-8(6-7)9-2;/h3-4,6,8H,5H2,1-2H3;1H.
What are the key properties of 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride?
6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride has a molecular weight of 160.64 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-methylcyclohexa-1,3-diene;hydrochloride is sourced from PubChem (CID 144964238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).