C20H25NO2Si — CID 123977382
N-(3-methoxycyclohexa-1,5-dien-1-yl)-N-(5-methoxycyclohexa-1,3-dien-1-yl)-4-silylaniline (PubChem CID 123977382) has the molecular formula C20H25NO2Si and a molecular weight of 339.51 g/mol. Its IUPAC name is N-(3-methoxycyclohexa-1,5-dien-1-yl)-N-(5-methoxycyclohexa-1,3-dien-1-yl)-4-silylaniline.
| Compound Name | N-(3-methoxycyclohexa-1,5-dien-1-yl)-N-(5-methoxycyclohexa-1,3-dien-1-yl)-4-silylaniline |
|---|---|
| PubChem CID | 123977382 |
| Molecular Formula | C20H25NO2Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-(3-methoxycyclohexa-1,5-dien-1-yl)-N-(5-methoxycyclohexa-1,3-dien-1-yl)-4-silylaniline |
| SMILES | COC1C=C(N(C2=CC=CC(OC)C2)c2ccc([SiH3])cc2)C=CC1 |
| InChI | InChI=1S/C20H25NO2Si/c1-22-18-7-3-5-16(13-18)21(15-9-11-20(24)12-10-15)17-6-4-8-19(14-17)23-2/h3-7,9-12,14,18-19H,8,13H2,1-2,24H3 |
| InChIKey | MXPPGNSKFQTUJG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|