C12H14O — CID 121011407
6-methoxy-6,7-dihydro-5H-benzo[7]annulene (PubChem CID 121011407) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 6-methoxy-6,7-dihydro-5H-benzo[7]annulene.
| Compound Name | 6-methoxy-6,7-dihydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 121011407 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 6-methoxy-6,7-dihydro-5H-benzo[7]annulene |
| SMILES | COC1CC=Cc2ccccc2C1 |
| InChI | InChI=1S/C12H14O/c1-13-12-8-4-7-10-5-2-3-6-11(10)9-12/h2-7,12H,8-9H2,1H3 |
| InChIKey | KNHPPRTXGKEOHU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |