C22H26O4 — CID 135068981
diethyl (3aR,7R)-7-phenyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 135068981) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is diethyl (3aR,7R)-7-phenyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,7R)-7-phenyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135068981 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | diethyl (3aR,7R)-7-phenyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C[C@H](c3ccccc3)CC=C[C@H]2C1 |
| InChI | InChI=1S/C22H26O4/c1-3-25-20(23)22(21(24)26-4-2)14-18-12-8-11-17(13-19(18)15-22)16-9-6-5-7-10-16/h5-10,12-13,17-18H,3-4,11,14-15H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | KVBAHTDAGBGNBA-MSOLQXFVSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|