C21H26O4 — CID 101390363
diethyl (3aR,4R,6aS)-6-methylidene-4-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 101390363) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is diethyl (3aR,4R,6aS)-6-methylidene-4-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,4R,6aS)-6-methylidene-4-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101390363 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | diethyl (3aR,4R,6aS)-6-methylidene-4-phenyl-1,3,3a,4,5,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | C=C1C[C@@H](c2ccccc2)[C@@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@H]12 |
| InChI | InChI=1S/C21H26O4/c1-4-24-19(22)21(20(23)25-5-2)12-17-14(3)11-16(18(17)13-21)15-9-7-6-8-10-15/h6-10,16-18H,3-5,11-13H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | UQDXQZDMQSFTOE-KSZLIROESA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|