C26H28O5 — CID 132595235
diethyl (3aR,4R,9bS)-4-(3-methylphenyl)-5-oxo-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate (PubChem CID 132595235) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is diethyl (3aR,4R,9bS)-4-(3-methylphenyl)-5-oxo-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,4R,9bS)-4-(3-methylphenyl)-5-oxo-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132595235 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | diethyl (3aR,4R,9bS)-4-(3-methylphenyl)-5-oxo-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2[C@H](C1)c1ccccc1C(=O)[C@H]2c1cccc(C)c1 |
| InChI | InChI=1S/C26H28O5/c1-4-30-24(28)26(25(29)31-5-2)14-20-18-11-6-7-12-19(18)23(27)22(21(20)15-26)17-10-8-9-16(3)13-17/h6-13,20-22H,4-5,14-15H2,1-3H3/t20-,21-,22+/m1/s1 |
| InChIKey | LPIWXAJUYFXFIV-VSKRKVRLSA-N |
| XLogP | 4.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|