C31H31NO6 — CID 138985106
diethyl (3R,3aS,9bR)-3,3a-bis(3-methylphenyl)-4-oxo-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate (PubChem CID 138985106) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is diethyl (3R,3aS,9bR)-3,3a-bis(3-methylphenyl)-4-oxo-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate.
| Compound Name | diethyl (3R,3aS,9bR)-3,3a-bis(3-methylphenyl)-4-oxo-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 138985106 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | diethyl (3R,3aS,9bR)-3,3a-bis(3-methylphenyl)-4-oxo-3,9b-dihydro-1H-chromeno[4,3-b]pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H]2c3ccccc3OC(=O)[C@]2(c2cccc(C)c2)[C@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C31H31NO6/c1-5-36-28(34)31(29(35)37-6-2)25(21-13-9-11-19(3)17-21)30(22-14-10-12-20(4)18-22)26(32-31)23-15-7-8-16-24(23)38-27(30)33/h7-18,25-26,32H,5-6H2,1-4H3/t25-,26-,30-/m1/s1 |
| InChIKey | WCIBWKVXTBKBSB-VOKYQHOCSA-N |
| XLogP | 4.45 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|