C21H20O4 — CID 134849802
ethyl 2-oxo-1-(9H-xanthen-9-yl)cyclopentane-1-carboxylate (PubChem CID 134849802) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl 2-oxo-1-(9H-xanthen-9-yl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-oxo-1-(9H-xanthen-9-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134849802 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl 2-oxo-1-(9H-xanthen-9-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C2c3ccccc3Oc3ccccc32)CCCC1=O |
| InChI | InChI=1S/C21H20O4/c1-2-24-20(23)21(13-7-12-18(21)22)19-14-8-3-5-10-16(14)25-17-11-6-4-9-15(17)19/h3-6,8-11,19H,2,7,12-13H2,1H3 |
| InChIKey | VGHOUHQDWMVRLH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|