C26H22O4 — CID 101167578
ethyl (6aR,8R,12bR)-6-oxo-8-phenyl-8,12b-dihydro-7H-naphtho[2,1-c]chromene-6a-carboxylate (PubChem CID 101167578) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl (6aR,8R,12bR)-6-oxo-8-phenyl-8,12b-dihydro-7H-naphtho[2,1-c]chromene-6a-carboxylate.
| Compound Name | ethyl (6aR,8R,12bR)-6-oxo-8-phenyl-8,12b-dihydro-7H-naphtho[2,1-c]chromene-6a-carboxylate |
|---|---|
| PubChem CID | 101167578 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl (6aR,8R,12bR)-6-oxo-8-phenyl-8,12b-dihydro-7H-naphtho[2,1-c]chromene-6a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H](c3ccccc3)c3ccccc3[C@@H]1c1ccccc1OC2=O |
| InChI | InChI=1S/C26H22O4/c1-2-29-24(27)26-16-21(17-10-4-3-5-11-17)18-12-6-7-13-19(18)23(26)20-14-8-9-15-22(20)30-25(26)28/h3-15,21,23H,2,16H2,1H3/t21-,23-,26-/m1/s1 |
| InChIKey | XUCWYCWFYNMKHV-WHSBFGAESA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|