C23H26O4 — CID 54763664
diethyl 9-phenyl-5,7,8,9-tetrahydrobenzo[7]annulene-6,6-dicarboxylate (PubChem CID 54763664) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is diethyl 9-phenyl-5,7,8,9-tetrahydrobenzo[7]annulene-6,6-dicarboxylate.
| Compound Name | diethyl 9-phenyl-5,7,8,9-tetrahydrobenzo[7]annulene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 54763664 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | diethyl 9-phenyl-5,7,8,9-tetrahydrobenzo[7]annulene-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(c2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C23H26O4/c1-3-26-21(24)23(22(25)27-4-2)15-14-20(17-10-6-5-7-11-17)19-13-9-8-12-18(19)16-23/h5-13,20H,3-4,14-16H2,1-2H3 |
| InChIKey | OESYHIBVQCZAFC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|