C29H29NO6 — CID 175969652
diethyl 4-[(4-phenoxyphenyl)carbamoyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 175969652) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is diethyl 4-[(4-phenoxyphenyl)carbamoyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-[(4-phenoxyphenyl)carbamoyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 175969652 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | diethyl 4-[(4-phenoxyphenyl)carbamoyl]-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccccc2C(C(=O)Nc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C29H29NO6/c1-3-34-27(32)29(28(33)35-4-2)18-20-10-8-9-13-24(20)25(19-29)26(31)30-21-14-16-23(17-15-21)36-22-11-6-5-7-12-22/h5-17,25H,3-4,18-19H2,1-2H3,(H,30,31) |
| InChIKey | ODYLHKNXEABKPF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|