C21H17F3O3 — CID 15530344
ethyl 15-(2,2,2-trifluoroacetyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate (PubChem CID 15530344) has the molecular formula C21H17F3O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is ethyl 15-(2,2,2-trifluoroacetyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate.
| Compound Name | ethyl 15-(2,2,2-trifluoroacetyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 15530344 |
| Molecular Formula | C21H17F3O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 15-(2,2,2-trifluoroacetyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)C(F)(F)F)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C21H17F3O3/c1-2-27-19(26)20(18(25)21(22,23)24)11-16-12-7-3-5-9-14(12)17(20)15-10-6-4-8-13(15)16/h3-10,16-17H,2,11H2,1H3 |
| InChIKey | JTXHTURDXPGPTR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|