C20H15F5O5S — CID 166909157
1,1-difluoro-2-oxo-2-[[15-(trifluoromethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methoxy]ethanesulfonic acid (PubChem CID 166909157) has the molecular formula C20H15F5O5S and a molecular weight of 462.39 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[15-(trifluoromethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[15-(trifluoromethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 166909157 |
| Molecular Formula | C20H15F5O5S |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[15-(trifluoromethyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methoxy]ethanesulfonic acid |
| SMILES | O=C(OCC1(C(F)(F)F)CC2c3ccccc3C1c1ccccc12)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C20H15F5O5S/c21-19(22,31(27,28)29)17(26)30-10-18(20(23,24)25)9-15-11-5-1-3-7-13(11)16(18)14-8-4-2-6-12(14)15/h1-8,15-16H,9-10H2,(H,27,28,29) |
| InChIKey | YLCDKUYKWAUSDB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|