C16H16O4 — CID 11507325
(6aS,10aS)-8,9-dimethyl-6-oxo-10,10a-dihydro-7H-benzo[c]chromene-6a-carboxylic acid (PubChem CID 11507325) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (6aS,10aS)-8,9-dimethyl-6-oxo-10,10a-dihydro-7H-benzo[c]chromene-6a-carboxylic acid.
| Compound Name | (6aS,10aS)-8,9-dimethyl-6-oxo-10,10a-dihydro-7H-benzo[c]chromene-6a-carboxylic acid |
|---|---|
| PubChem CID | 11507325 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (6aS,10aS)-8,9-dimethyl-6-oxo-10,10a-dihydro-7H-benzo[c]chromene-6a-carboxylic acid |
| SMILES | CC1=C(C)C[C@]2(C(=O)O)C(=O)Oc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C16H16O4/c1-9-7-12-11-5-3-4-6-13(11)20-15(19)16(12,14(17)18)8-10(9)2/h3-6,12H,7-8H2,1-2H3,(H,17,18)/t12-,16-/m0/s1 |
| InChIKey | XCWJNRBIENYHAM-LRDDRELGSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|