C18H16O3 — CID 102279128
4-[2-(4-methylphenyl)-2-oxoethyl]-3,4-dihydrochromen-2-one (PubChem CID 102279128) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)-2-oxoethyl]-3,4-dihydrochromen-2-one.
| Compound Name | 4-[2-(4-methylphenyl)-2-oxoethyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 102279128 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[2-(4-methylphenyl)-2-oxoethyl]-3,4-dihydrochromen-2-one |
| SMILES | Cc1ccc(C(=O)CC2CC(=O)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C18H16O3/c1-12-6-8-13(9-7-12)16(19)10-14-11-18(20)21-17-5-3-2-4-15(14)17/h2-9,14H,10-11H2,1H3 |
| InChIKey | WLYKENZIYHNRLW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|