C17H13BrO3 — CID 102279135
6-bromo-4-phenacyl-3,4-dihydrochromen-2-one (PubChem CID 102279135) has the molecular formula C17H13BrO3 and a molecular weight of 345.19 g/mol. Its IUPAC name is 6-bromo-4-phenacyl-3,4-dihydrochromen-2-one.
| Compound Name | 6-bromo-4-phenacyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 102279135 |
| Molecular Formula | C17H13BrO3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 6-bromo-4-phenacyl-3,4-dihydrochromen-2-one |
| SMILES | O=C1CC(CC(=O)c2ccccc2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C17H13BrO3/c18-13-6-7-16-14(10-13)12(9-17(20)21-16)8-15(19)11-4-2-1-3-5-11/h1-7,10,12H,8-9H2 |
| InChIKey | YYAFSZAAJVTOMZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|